C17H21FN2O3 — CID 91956097
1-[(2-fluorophenyl)methyl]-5-oxo-N-(oxolan-2-ylmethyl)pyrrolidine-2-carboxamide (PubChem CID 91956097) has the molecular formula C17H21FN2O3 and a molecular weight of 320.36 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-5-oxo-N-(oxolan-2-ylmethyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[(2-fluorophenyl)methyl]-5-oxo-N-(oxolan-2-ylmethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91956097 |
| Molecular Formula | C17H21FN2O3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-5-oxo-N-(oxolan-2-ylmethyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCC1CCCO1)C1CCC(=O)N1Cc1ccccc1F |
| InChI | InChI=1S/C17H21FN2O3/c18-14-6-2-1-4-12(14)11-20-15(7-8-16(20)21)17(22)19-10-13-5-3-9-23-13/h1-2,4,6,13,15H,3,5,7-11H2,(H,19,22) |
| InChIKey | VLGSUKZUAMZOCG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |