C19H22FN5O4 — CID 98042307
2-[7-[(2-fluorophenyl)methyl]-3,8-dioxo-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-2-yl]-N-[[(2R)-oxolan-2-yl]methyl]acetamide (PubChem CID 98042307) has the molecular formula C19H22FN5O4 and a molecular weight of 403.41 g/mol. Its IUPAC name is 2-[7-[(2-fluorophenyl)methyl]-3,8-dioxo-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-2-yl]-N-[[(2R)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-[7-[(2-fluorophenyl)methyl]-3,8-dioxo-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-2-yl]-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 98042307 |
| Molecular Formula | C19H22FN5O4 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 2-[7-[(2-fluorophenyl)methyl]-3,8-dioxo-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-2-yl]-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
| SMILES | O=C(Cn1nc2n(c1=O)CCN(Cc1ccccc1F)C2=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C19H22FN5O4/c20-15-6-2-1-4-13(15)11-23-7-8-24-17(18(23)27)22-25(19(24)28)12-16(26)21-10-14-5-3-9-29-14/h1-2,4,6,14H,3,5,7-12H2,(H,21,26)/t14-/m1/s1 |
| InChIKey | QTUBFTBNQKQIHF-CQSZACIVSA-N |
| XLogP | 0.14 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |