C14H17N5O3 — CID 9379923
N-[[(2S)-oxolan-2-yl]methyl]-2-(5-oxo-4-phenyltetrazol-1-yl)acetamide (PubChem CID 9379923) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is N-[[(2S)-oxolan-2-yl]methyl]-2-(5-oxo-4-phenyltetrazol-1-yl)acetamide.
| Compound Name | N-[[(2S)-oxolan-2-yl]methyl]-2-(5-oxo-4-phenyltetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 9379923 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-[[(2S)-oxolan-2-yl]methyl]-2-(5-oxo-4-phenyltetrazol-1-yl)acetamide |
| SMILES | O=C(Cn1nnn(-c2ccccc2)c1=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C14H17N5O3/c20-13(15-9-12-7-4-8-22-12)10-18-14(21)19(17-16-18)11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H,15,20)/t12-/m0/s1 |
| InChIKey | GQXHLEIFOXAKDI-LBPRGKRZSA-N |
| XLogP | -0.28 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |