C17H17N3O4 — CID 5308120
2-(4-oxochromeno[3,4-d]pyrazol-1-yl)-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 5308120) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-(4-oxochromeno[3,4-d]pyrazol-1-yl)-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-(4-oxochromeno[3,4-d]pyrazol-1-yl)-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 5308120 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-(4-oxochromeno[3,4-d]pyrazol-1-yl)-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1ncc2c(=O)oc3ccccc3c21)NCC1CCCO1 |
| InChI | InChI=1S/C17H17N3O4/c21-15(18-8-11-4-3-7-23-11)10-20-16-12-5-1-2-6-14(12)24-17(22)13(16)9-19-20/h1-2,5-6,9,11H,3-4,7-8,10H2,(H,18,21) |
| InChIKey | RRFGOQCRZKOLDC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|