About 2-(7-fluoro-2,3-dihydroindol-1-yl)-N-(oxolan-2-ylmethyl)acetamide
2-(7-fluoro-2,3-dihydroindol-1-yl)-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 75431188) has the molecular formula C15H19FN2O2
and a molecular weight of 278.33 g/mol. Its IUPAC name is 2-(7-fluoro-2,3-dihydroindol-1-yl)-N-(oxolan-2-ylmethyl)acetamide.
Molecular Properties
| Compound Name | 2-(7-fluoro-2,3-dihydroindol-1-yl)-N-(oxolan-2-ylmethyl)acetamide |
| PubChem CID | 75431188 |
| Molecular Formula | C15H19FN2O2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-(7-fluoro-2,3-dihydroindol-1-yl)-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=C(CN1CCc2cccc(F)c21)NCC1CCCO1 |
| InChI | InChI=1S/C15H19FN2O2/c16-13-5-1-3-11-6-7-18(15(11)13)10-14(19)17-9-12-4-2-8-20-12/h1,3,5,12H,2,4,6-10H2,(H,17,19) |
| InChIKey | AOXPVQAEKAXXBS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(7-fluoro-2,3-dihydroindol-1-yl)-N-(oxolan-2-ylmethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-fluoro-2,3-dihydroindol-1-yl)-N-(oxolan-2-ylmethyl)acetamide?
The IUPAC name of 2-(7-fluoro-2,3-dihydroindol-1-yl)-N-(oxolan-2-ylmethyl)acetamide (CID 75431188) is 2-(7-fluoro-2,3-dihydroindol-1-yl)-N-(oxolan-2-ylmethyl)acetamide.
What is the SMILES notation for 2-(7-fluoro-2,3-dihydroindol-1-yl)-N-(oxolan-2-ylmethyl)acetamide?
The canonical SMILES for 2-(7-fluoro-2,3-dihydroindol-1-yl)-N-(oxolan-2-ylmethyl)acetamide is O=C(CN1CCc2cccc(F)c21)NCC1CCCO1.
What is the InChIKey of 2-(7-fluoro-2,3-dihydroindol-1-yl)-N-(oxolan-2-ylmethyl)acetamide?
The InChIKey is AOXPVQAEKAXXBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FN2O2/c16-13-5-1-3-11-6-7-18(15(11)13)10-14(19)17-9-12-4-2-8-20-12/h1,3,5,12H,2,4,6-10H2,(H,17,19).
What are the key properties of 2-(7-fluoro-2,3-dihydroindol-1-yl)-N-(oxolan-2-ylmethyl)acetamide?
2-(7-fluoro-2,3-dihydroindol-1-yl)-N-(oxolan-2-ylmethyl)acetamide has a molecular weight of 278.33 g/mol, XLogP of 1.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-fluoro-2,3-dihydroindol-1-yl)-N-(oxolan-2-ylmethyl)acetamide is sourced from PubChem (CID 75431188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).