C15H19FN2O2 — CID 75431188
2-(7-fluoro-2,3-dihydroindol-1-yl)-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 75431188) has the molecular formula C15H19FN2O2 and a molecular weight of 278.33 g/mol. Its IUPAC name is 2-(7-fluoro-2,3-dihydroindol-1-yl)-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-(7-fluoro-2,3-dihydroindol-1-yl)-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 75431188 |
| Molecular Formula | C15H19FN2O2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-(7-fluoro-2,3-dihydroindol-1-yl)-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=C(CN1CCc2cccc(F)c21)NCC1CCCO1 |
| InChI | InChI=1S/C15H19FN2O2/c16-13-5-1-3-11-6-7-18(15(11)13)10-14(19)17-9-12-4-2-8-20-12/h1,3,5,12H,2,4,6-10H2,(H,17,19) |
| InChIKey | AOXPVQAEKAXXBS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |