C22H25N3O3 — CID 54810727
3-[[2-(2,3-dihydroindol-1-yl)acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 54810727) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-[[2-(2,3-dihydroindol-1-yl)acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-[[2-(2,3-dihydroindol-1-yl)acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 54810727 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 3-[[2-(2,3-dihydroindol-1-yl)acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(CN1CCc2ccccc21)Nc1cccc(C(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C22H25N3O3/c26-21(15-25-11-10-16-5-1-2-9-20(16)25)24-18-7-3-6-17(13-18)22(27)23-14-19-8-4-12-28-19/h1-3,5-7,9,13,19H,4,8,10-12,14-15H2,(H,23,27)(H,24,26) |
| InChIKey | DNVDUFIWAOYHGZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |