C20H23FN2O4 — CID 16852776
2-[5-[(2-fluorophenyl)methoxy]-2-methyl-4-oxo-1-pyridinyl]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 16852776) has the molecular formula C20H23FN2O4 and a molecular weight of 374.41 g/mol. Its IUPAC name is 2-[5-[(2-fluorophenyl)methoxy]-2-methyl-4-oxo-1-pyridinyl]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[5-[(2-fluorophenyl)methoxy]-2-methyl-4-oxo-1-pyridinyl]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 16852776 |
| Molecular Formula | C20H23FN2O4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-[5-[(2-fluorophenyl)methoxy]-2-methyl-4-oxo-1-pyridinyl]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | Cc1cc(=O)c(OCc2ccccc2F)cn1CC(=O)NCC1CCCO1 |
| InChI | InChI=1S/C20H23FN2O4/c1-14-9-18(24)19(27-13-15-5-2-3-7-17(15)21)11-23(14)12-20(25)22-10-16-6-4-8-26-16/h2-3,5,7,9,11,16H,4,6,8,10,12-13H2,1H3,(H,22,25) |
| InChIKey | FEJAGSURBRMCJC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |