C23H24FN3O2 — CID 91956083
1-[(2-fluorophenyl)methyl]-N-(3-indol-1-ylpropyl)-5-oxopyrrolidine-2-carboxamide (PubChem CID 91956083) has the molecular formula C23H24FN3O2 and a molecular weight of 393.46 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-N-(3-indol-1-ylpropyl)-5-oxopyrrolidine-2-carboxamide.
| Compound Name | 1-[(2-fluorophenyl)methyl]-N-(3-indol-1-ylpropyl)-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91956083 |
| Molecular Formula | C23H24FN3O2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-N-(3-indol-1-ylpropyl)-5-oxopyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCn1ccc2ccccc21)C1CCC(=O)N1Cc1ccccc1F |
| InChI | InChI=1S/C23H24FN3O2/c24-19-8-3-1-7-18(19)16-27-21(10-11-22(27)28)23(29)25-13-5-14-26-15-12-17-6-2-4-9-20(17)26/h1-4,6-9,12,15,21H,5,10-11,13-14,16H2,(H,25,29) |
| InChIKey | XYGXCBTVCPWYGR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|