C24H26FN3O2 — CID 45194300
1-[(3-fluorophenyl)methyl]-N-(3-indol-1-ylpropyl)-6-oxopiperidine-3-carboxamide (PubChem CID 45194300) has the molecular formula C24H26FN3O2 and a molecular weight of 407.49 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-N-(3-indol-1-ylpropyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | 1-[(3-fluorophenyl)methyl]-N-(3-indol-1-ylpropyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 45194300 |
| Molecular Formula | C24H26FN3O2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-N-(3-indol-1-ylpropyl)-6-oxopiperidine-3-carboxamide |
| SMILES | O=C(NCCCn1ccc2ccccc21)C1CCC(=O)N(Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C24H26FN3O2/c25-21-7-3-5-18(15-21)16-28-17-20(9-10-23(28)29)24(30)26-12-4-13-27-14-11-19-6-1-2-8-22(19)27/h1-3,5-8,11,14-15,20H,4,9-10,12-13,16-17H2,(H,26,30) |
| InChIKey | MXZGWIHFAREQJD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|