C20H25FN4O2 — CID 42511476
(3R)-1-[2-(3-fluorophenyl)ethyl]-N-(3-imidazol-1-ylpropyl)-6-oxopiperidine-3-carboxamide (PubChem CID 42511476) has the molecular formula C20H25FN4O2 and a molecular weight of 372.44 g/mol. Its IUPAC name is (3R)-1-[2-(3-fluorophenyl)ethyl]-N-(3-imidazol-1-ylpropyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | (3R)-1-[2-(3-fluorophenyl)ethyl]-N-(3-imidazol-1-ylpropyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42511476 |
| Molecular Formula | C20H25FN4O2 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (3R)-1-[2-(3-fluorophenyl)ethyl]-N-(3-imidazol-1-ylpropyl)-6-oxopiperidine-3-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)[C@@H]1CCC(=O)N(CCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C20H25FN4O2/c21-18-4-1-3-16(13-18)7-11-25-14-17(5-6-19(25)26)20(27)23-8-2-10-24-12-9-22-15-24/h1,3-4,9,12-13,15,17H,2,5-8,10-11,14H2,(H,23,27)/t17-/m1/s1 |
| InChIKey | AKGBHWWVQPGJJX-QGZVFWFLSA-N |
| XLogP | 2.01 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|