C21H26FN3O2S — CID 25371045
(3S)-1-[2-(3-fluorophenyl)ethyl]-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]-6-oxopiperidine-3-carboxamide (PubChem CID 25371045) has the molecular formula C21H26FN3O2S and a molecular weight of 403.52 g/mol. Its IUPAC name is (3S)-1-[2-(3-fluorophenyl)ethyl]-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | (3S)-1-[2-(3-fluorophenyl)ethyl]-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 25371045 |
| Molecular Formula | C21H26FN3O2S |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | (3S)-1-[2-(3-fluorophenyl)ethyl]-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]-6-oxopiperidine-3-carboxamide |
| SMILES | Cc1ncsc1CCCNC(=O)[C@H]1CCC(=O)N(CCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C21H26FN3O2S/c1-15-19(28-14-24-15)6-3-10-23-21(27)17-7-8-20(26)25(13-17)11-9-16-4-2-5-18(22)12-16/h2,4-5,12,14,17H,3,6-11,13H2,1H3,(H,23,27)/t17-/m0/s1 |
| InChIKey | AQHFMIQVJBQMHO-KRWDZBQOSA-N |
| XLogP | 3.12 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|