C19H25FN2O4 — CID 26410547
ethyl 3-[[(3S)-1-[2-(3-fluorophenyl)ethyl]-6-oxopiperidine-3-carbonyl]amino]propanoate (PubChem CID 26410547) has the molecular formula C19H25FN2O4 and a molecular weight of 364.42 g/mol. Its IUPAC name is ethyl 3-[[(3S)-1-[2-(3-fluorophenyl)ethyl]-6-oxopiperidine-3-carbonyl]amino]propanoate.
| Compound Name | ethyl 3-[[(3S)-1-[2-(3-fluorophenyl)ethyl]-6-oxopiperidine-3-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 26410547 |
| Molecular Formula | C19H25FN2O4 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | ethyl 3-[[(3S)-1-[2-(3-fluorophenyl)ethyl]-6-oxopiperidine-3-carbonyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)[C@H]1CCC(=O)N(CCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C19H25FN2O4/c1-2-26-18(24)8-10-21-19(25)15-6-7-17(23)22(13-15)11-9-14-4-3-5-16(20)12-14/h3-5,12,15H,2,6-11,13H2,1H3,(H,21,25)/t15-/m0/s1 |
| InChIKey | OQTFLZSKZOUSNP-HNNXBMFYSA-N |
| XLogP | 1.68 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |