C19H27FN2O3 — CID 25485620
(3S)-N-(3-ethoxypropyl)-1-[2-(3-fluorophenyl)ethyl]-6-oxopiperidine-3-carboxamide (PubChem CID 25485620) has the molecular formula C19H27FN2O3 and a molecular weight of 350.43 g/mol. Its IUPAC name is (3S)-N-(3-ethoxypropyl)-1-[2-(3-fluorophenyl)ethyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | (3S)-N-(3-ethoxypropyl)-1-[2-(3-fluorophenyl)ethyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 25485620 |
| Molecular Formula | C19H27FN2O3 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (3S)-N-(3-ethoxypropyl)-1-[2-(3-fluorophenyl)ethyl]-6-oxopiperidine-3-carboxamide |
| SMILES | CCOCCCNC(=O)[C@H]1CCC(=O)N(CCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C19H27FN2O3/c1-2-25-12-4-10-21-19(24)16-7-8-18(23)22(14-16)11-9-15-5-3-6-17(20)13-15/h3,5-6,13,16H,2,4,7-12,14H2,1H3,(H,21,24)/t16-/m0/s1 |
| InChIKey | IHQVASHVLDTIKH-INIZCTEOSA-N |
| XLogP | 2.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|