C22H26FN3O2 — CID 42521558
(3R)-1-[2-(3-fluorophenyl)ethyl]-6-oxo-N-(3-pyridin-3-ylpropyl)piperidine-3-carboxamide (PubChem CID 42521558) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is (3R)-1-[2-(3-fluorophenyl)ethyl]-6-oxo-N-(3-pyridin-3-ylpropyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-[2-(3-fluorophenyl)ethyl]-6-oxo-N-(3-pyridin-3-ylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42521558 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | (3R)-1-[2-(3-fluorophenyl)ethyl]-6-oxo-N-(3-pyridin-3-ylpropyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCCc1cccnc1)[C@@H]1CCC(=O)N(CCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C22H26FN3O2/c23-20-7-1-4-17(14-20)10-13-26-16-19(8-9-21(26)27)22(28)25-12-3-6-18-5-2-11-24-15-18/h1-2,4-5,7,11,14-15,19H,3,6,8-10,12-13,16H2,(H,25,28)/t19-/m1/s1 |
| InChIKey | HDNOVZVBMKAWFN-LJQANCHMSA-N |
| XLogP | 2.75 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|