C21H25N3O2 — CID 42592382
(3S)-6-oxo-1-(2-phenylethyl)-N-(2-pyridin-3-ylethyl)piperidine-3-carboxamide (PubChem CID 42592382) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is (3S)-6-oxo-1-(2-phenylethyl)-N-(2-pyridin-3-ylethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-6-oxo-1-(2-phenylethyl)-N-(2-pyridin-3-ylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42592382 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | (3S)-6-oxo-1-(2-phenylethyl)-N-(2-pyridin-3-ylethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCc1cccnc1)[C@H]1CCC(=O)N(CCc2ccccc2)C1 |
| InChI | InChI=1S/C21H25N3O2/c25-20-9-8-19(16-24(20)14-11-17-5-2-1-3-6-17)21(26)23-13-10-18-7-4-12-22-15-18/h1-7,12,15,19H,8-11,13-14,16H2,(H,23,26)/t19-/m0/s1 |
| InChIKey | YKHGKSQKMOKTNN-IBGZPJMESA-N |
| XLogP | 2.22 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |