C23H24FN3O2 — CID 91954585
N-[3-(2-fluorophenyl)propyl]-1-(1H-indol-3-ylmethyl)-5-oxopyrrolidine-2-carboxamide (PubChem CID 91954585) has the molecular formula C23H24FN3O2 and a molecular weight of 393.46 g/mol. Its IUPAC name is N-[3-(2-fluorophenyl)propyl]-1-(1H-indol-3-ylmethyl)-5-oxopyrrolidine-2-carboxamide.
| Compound Name | N-[3-(2-fluorophenyl)propyl]-1-(1H-indol-3-ylmethyl)-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91954585 |
| Molecular Formula | C23H24FN3O2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | N-[3-(2-fluorophenyl)propyl]-1-(1H-indol-3-ylmethyl)-5-oxopyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCc1ccccc1F)C1CCC(=O)N1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H24FN3O2/c24-19-9-3-1-6-16(19)7-5-13-25-23(29)21-11-12-22(28)27(21)15-17-14-26-20-10-4-2-8-18(17)20/h1-4,6,8-10,14,21,26H,5,7,11-13,15H2,(H,25,29) |
| InChIKey | BJRCCYBKXHSEBD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|