C27H31N3O2 — CID 91955683
1-(1H-indol-3-ylmethyl)-5-oxo-N-[(1-phenylcyclohexyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 91955683) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 1-(1H-indol-3-ylmethyl)-5-oxo-N-[(1-phenylcyclohexyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(1H-indol-3-ylmethyl)-5-oxo-N-[(1-phenylcyclohexyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91955683 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 1-(1H-indol-3-ylmethyl)-5-oxo-N-[(1-phenylcyclohexyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCC1(c2ccccc2)CCCCC1)C1CCC(=O)N1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H31N3O2/c31-25-14-13-24(30(25)18-20-17-28-23-12-6-5-11-22(20)23)26(32)29-19-27(15-7-2-8-16-27)21-9-3-1-4-10-21/h1,3-6,9-12,17,24,28H,2,7-8,13-16,18-19H2,(H,29,32) |
| InChIKey | JZPZJXDGFDNFSX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |