C15H9Cl3N2O — CID 2448530
N-(3-chloro-4-cyanophenyl)-2-(3,4-dichlorophenyl)acetamide (PubChem CID 2448530) has the molecular formula C15H9Cl3N2O and a molecular weight of 339.61 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 2448530 |
| Molecular Formula | C15H9Cl3N2O |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-(3,4-dichlorophenyl)acetamide |
| SMILES | N#Cc1ccc(NC(=O)Cc2ccc(Cl)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C15H9Cl3N2O/c16-12-4-1-9(5-14(12)18)6-15(21)20-11-3-2-10(8-19)13(17)7-11/h1-5,7H,6H2,(H,20,21) |
| InChIKey | UCLGJLSUZSJCPB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |