C23H17ClN2O3 — CID 7703794
[2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-(4-phenylphenyl)acetate (PubChem CID 7703794) has the molecular formula C23H17ClN2O3 and a molecular weight of 404.85 g/mol. Its IUPAC name is [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-(4-phenylphenyl)acetate.
| Compound Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-(4-phenylphenyl)acetate |
|---|---|
| PubChem CID | 7703794 |
| Molecular Formula | C23H17ClN2O3 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-(4-phenylphenyl)acetate |
| SMILES | N#Cc1ccc(NC(=O)COC(=O)Cc2ccc(-c3ccccc3)cc2)cc1Cl |
| InChI | InChI=1S/C23H17ClN2O3/c24-21-13-20(11-10-19(21)14-25)26-22(27)15-29-23(28)12-16-6-8-18(9-7-16)17-4-2-1-3-5-17/h1-11,13H,12,15H2,(H,26,27) |
| InChIKey | PKZBPVHFCBSKHN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |