C18H14ClFN2O4 — CID 8667266
[2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-(3-fluoro-4-methoxyphenyl)acetate (PubChem CID 8667266) has the molecular formula C18H14ClFN2O4 and a molecular weight of 376.77 g/mol. Its IUPAC name is [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-(3-fluoro-4-methoxyphenyl)acetate.
| Compound Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-(3-fluoro-4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 8667266 |
| Molecular Formula | C18H14ClFN2O4 |
| Molecular Weight | 376.77 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-(3-fluoro-4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)OCC(=O)Nc2ccc(C#N)c(Cl)c2)cc1F |
| InChI | InChI=1S/C18H14ClFN2O4/c1-25-16-5-2-11(6-15(16)20)7-18(24)26-10-17(23)22-13-4-3-12(9-21)14(19)8-13/h2-6,8H,7,10H2,1H3,(H,22,23) |
| InChIKey | YKWOVKIZMCEBTD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.77 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |