C19H19ClFN3O2 — CID 9349330
N-(3-chloro-4-cyanophenyl)-2-[ethyl-[(3-fluoro-4-methoxyphenyl)methyl]amino]acetamide (PubChem CID 9349330) has the molecular formula C19H19ClFN3O2 and a molecular weight of 375.83 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-[ethyl-[(3-fluoro-4-methoxyphenyl)methyl]amino]acetamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-[ethyl-[(3-fluoro-4-methoxyphenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 9349330 |
| Molecular Formula | C19H19ClFN3O2 |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-[ethyl-[(3-fluoro-4-methoxyphenyl)methyl]amino]acetamide |
| SMILES | CCN(CC(=O)Nc1ccc(C#N)c(Cl)c1)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C19H19ClFN3O2/c1-3-24(11-13-4-7-18(26-2)17(21)8-13)12-19(25)23-15-6-5-14(10-22)16(20)9-15/h4-9H,3,11-12H2,1-2H3,(H,23,25) |
| InChIKey | MSHSHXJKBCUDTM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |