C20H23FN2O4 — CID 9349462
methyl 4-[[2-[ethyl-[(3-fluoro-4-methoxyphenyl)methyl]amino]acetyl]amino]benzoate (PubChem CID 9349462) has the molecular formula C20H23FN2O4 and a molecular weight of 374.41 g/mol. Its IUPAC name is methyl 4-[[2-[ethyl-[(3-fluoro-4-methoxyphenyl)methyl]amino]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[ethyl-[(3-fluoro-4-methoxyphenyl)methyl]amino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 9349462 |
| Molecular Formula | C20H23FN2O4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | methyl 4-[[2-[ethyl-[(3-fluoro-4-methoxyphenyl)methyl]amino]acetyl]amino]benzoate |
| SMILES | CCN(CC(=O)Nc1ccc(C(=O)OC)cc1)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C20H23FN2O4/c1-4-23(12-14-5-10-18(26-2)17(21)11-14)13-19(24)22-16-8-6-15(7-9-16)20(25)27-3/h5-11H,4,12-13H2,1-3H3,(H,22,24) |
| InChIKey | JOOQCLYQVZPSFA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |