C21H25FN2O4 — CID 9432650
propan-2-yl 4-[[2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]acetyl]amino]benzoate (PubChem CID 9432650) has the molecular formula C21H25FN2O4 and a molecular weight of 388.44 g/mol. Its IUPAC name is propan-2-yl 4-[[2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]acetyl]amino]benzoate.
| Compound Name | propan-2-yl 4-[[2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 9432650 |
| Molecular Formula | C21H25FN2O4 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | propan-2-yl 4-[[2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]acetyl]amino]benzoate |
| SMILES | COc1ccc(CN(C)CC(=O)Nc2ccc(C(=O)OC(C)C)cc2)cc1F |
| InChI | InChI=1S/C21H25FN2O4/c1-14(2)28-21(26)16-6-8-17(9-7-16)23-20(25)13-24(3)12-15-5-10-19(27-4)18(22)11-15/h5-11,14H,12-13H2,1-4H3,(H,23,25) |
| InChIKey | KYMMXWVDEVPYTB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |