C18H20BrFN2O2 — CID 9431404
N-(4-bromo-3-methylphenyl)-2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]acetamide (PubChem CID 9431404) has the molecular formula C18H20BrFN2O2 and a molecular weight of 395.27 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]acetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 9431404 |
| Molecular Formula | C18H20BrFN2O2 |
| Molecular Weight | 395.27 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]acetamide |
| SMILES | COc1ccc(CN(C)CC(=O)Nc2ccc(Br)c(C)c2)cc1F |
| InChI | InChI=1S/C18H20BrFN2O2/c1-12-8-14(5-6-15(12)19)21-18(23)11-22(2)10-13-4-7-17(24-3)16(20)9-13/h4-9H,10-11H2,1-3H3,(H,21,23) |
| InChIKey | YQUVRQGDSYAMAP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |