C19H21FN2O4 — CID 18196329
N-[2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]acetyl]-4-methoxybenzamide (PubChem CID 18196329) has the molecular formula C19H21FN2O4 and a molecular weight of 360.39 g/mol. Its IUPAC name is N-[2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]acetyl]-4-methoxybenzamide.
| Compound Name | N-[2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]acetyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 18196329 |
| Molecular Formula | C19H21FN2O4 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-[2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]acetyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=O)CN(C)Cc2ccc(OC)c(F)c2)cc1 |
| InChI | InChI=1S/C19H21FN2O4/c1-22(11-13-4-9-17(26-3)16(20)10-13)12-18(23)21-19(24)14-5-7-15(25-2)8-6-14/h4-10H,11-12H2,1-3H3,(H,21,23,24) |
| InChIKey | IRTNVQQVRJOURD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |