C17H17F2N3O3 — CID 18144096
3-[(4-fluorobenzoyl)amino]-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methylurea (PubChem CID 18144096) has the molecular formula C17H17F2N3O3 and a molecular weight of 349.34 g/mol. Its IUPAC name is 3-[(4-fluorobenzoyl)amino]-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methylurea.
| Compound Name | 3-[(4-fluorobenzoyl)amino]-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 18144096 |
| Molecular Formula | C17H17F2N3O3 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 3-[(4-fluorobenzoyl)amino]-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methylurea |
| SMILES | COc1ccc(CN(C)C(=O)NNC(=O)c2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C17H17F2N3O3/c1-22(10-11-3-8-15(25-2)14(19)9-11)17(24)21-20-16(23)12-4-6-13(18)7-5-12/h3-9H,10H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | FYQJZPVGDFWUJL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|