C16H14BrF2N3O2 — CID 86867232
1-[(5-bromo-2-fluorophenyl)methyl]-3-[(4-fluorobenzoyl)amino]-1-methylurea (PubChem CID 86867232) has the molecular formula C16H14BrF2N3O2 and a molecular weight of 398.21 g/mol. Its IUPAC name is 1-[(5-bromo-2-fluorophenyl)methyl]-3-[(4-fluorobenzoyl)amino]-1-methylurea.
| Compound Name | 1-[(5-bromo-2-fluorophenyl)methyl]-3-[(4-fluorobenzoyl)amino]-1-methylurea |
|---|---|
| PubChem CID | 86867232 |
| Molecular Formula | C16H14BrF2N3O2 |
| Molecular Weight | 398.21 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 1-[(5-bromo-2-fluorophenyl)methyl]-3-[(4-fluorobenzoyl)amino]-1-methylurea |
| SMILES | CN(Cc1cc(Br)ccc1F)C(=O)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H14BrF2N3O2/c1-22(9-11-8-12(17)4-7-14(11)19)16(24)21-20-15(23)10-2-5-13(18)6-3-10/h2-8H,9H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | WSEAFPGHYNCCJZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.21 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|