C20H28FN3O3 — CID 9432639
N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]acetamide (PubChem CID 9432639) has the molecular formula C20H28FN3O3 and a molecular weight of 377.46 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 9432639 |
| Molecular Formula | C20H28FN3O3 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]acetamide |
| SMILES | COc1ccc(CN(C)CC(=O)NC(=O)NCCC2=CCCCC2)cc1F |
| InChI | InChI=1S/C20H28FN3O3/c1-24(13-16-8-9-18(27-2)17(21)12-16)14-19(25)23-20(26)22-11-10-15-6-4-3-5-7-15/h6,8-9,12H,3-5,7,10-11,13-14H2,1-2H3,(H2,22,23,25,26) |
| InChIKey | JQMBWSNTTNWXAC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|