C21H24ClN3O4 — CID 9166836
propan-2-yl 4-[[2-[[2-(4-chloroanilino)-2-oxoethyl]-methylamino]acetyl]amino]benzoate (PubChem CID 9166836) has the molecular formula C21H24ClN3O4 and a molecular weight of 417.89 g/mol. Its IUPAC name is propan-2-yl 4-[[2-[[2-(4-chloroanilino)-2-oxoethyl]-methylamino]acetyl]amino]benzoate.
| Compound Name | propan-2-yl 4-[[2-[[2-(4-chloroanilino)-2-oxoethyl]-methylamino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 9166836 |
| Molecular Formula | C21H24ClN3O4 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | propan-2-yl 4-[[2-[[2-(4-chloroanilino)-2-oxoethyl]-methylamino]acetyl]amino]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(NC(=O)CN(C)CC(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H24ClN3O4/c1-14(2)29-21(28)15-4-8-17(9-5-15)23-19(26)12-25(3)13-20(27)24-18-10-6-16(22)7-11-18/h4-11,14H,12-13H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | FWWDRIGBVYTLLV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |