C19H20ClN3O3 — CID 9167165
N-(4-acetylphenyl)-2-[[2-(4-chloroanilino)-2-oxoethyl]-methylamino]acetamide (PubChem CID 9167165) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-[[2-(4-chloroanilino)-2-oxoethyl]-methylamino]acetamide.
| Compound Name | N-(4-acetylphenyl)-2-[[2-(4-chloroanilino)-2-oxoethyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 9167165 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-(4-acetylphenyl)-2-[[2-(4-chloroanilino)-2-oxoethyl]-methylamino]acetamide |
| SMILES | CC(=O)c1ccc(NC(=O)CN(C)CC(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H20ClN3O3/c1-13(24)14-3-7-16(8-4-14)21-18(25)11-23(2)12-19(26)22-17-9-5-15(20)6-10-17/h3-10H,11-12H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | SDAQLRSJIJUUDD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |