C14H20FNO3 — CID 60696173
ethyl 2-[ethyl-[(3-fluoro-4-methoxyphenyl)methyl]amino]acetate (PubChem CID 60696173) has the molecular formula C14H20FNO3 and a molecular weight of 269.32 g/mol. Its IUPAC name is ethyl 2-[ethyl-[(3-fluoro-4-methoxyphenyl)methyl]amino]acetate.
| Compound Name | ethyl 2-[ethyl-[(3-fluoro-4-methoxyphenyl)methyl]amino]acetate |
|---|---|
| PubChem CID | 60696173 |
| Molecular Formula | C14H20FNO3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | ethyl 2-[ethyl-[(3-fluoro-4-methoxyphenyl)methyl]amino]acetate |
| SMILES | CCOC(=O)CN(CC)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C14H20FNO3/c1-4-16(10-14(17)19-5-2)9-11-6-7-13(18-3)12(15)8-11/h6-8H,4-5,9-10H2,1-3H3 |
| InChIKey | QNPJMLOKAAJVIW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |