C19H22F2N2O2 — CID 9349212
2-[ethyl-[(3-fluoro-4-methoxyphenyl)methyl]amino]-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 9349212) has the molecular formula C19H22F2N2O2 and a molecular weight of 348.39 g/mol. Its IUPAC name is 2-[ethyl-[(3-fluoro-4-methoxyphenyl)methyl]amino]-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[ethyl-[(3-fluoro-4-methoxyphenyl)methyl]amino]-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 9349212 |
| Molecular Formula | C19H22F2N2O2 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-[ethyl-[(3-fluoro-4-methoxyphenyl)methyl]amino]-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | CCN(CC(=O)NCc1ccc(F)cc1)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C19H22F2N2O2/c1-3-23(12-15-6-9-18(25-2)17(21)10-15)13-19(24)22-11-14-4-7-16(20)8-5-14/h4-10H,3,11-13H2,1-2H3,(H,22,24) |
| InChIKey | FAEQQJOLYINHNX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |