C15H24N2O3 — CID 32661950
2-[(3,4-dimethoxyphenyl)methyl-ethylamino]-N-ethylacetamide (PubChem CID 32661950) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl-ethylamino]-N-ethylacetamide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl-ethylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 32661950 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl-ethylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CN(CC)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H24N2O3/c1-5-16-15(18)11-17(6-2)10-12-7-8-13(19-3)14(9-12)20-4/h7-9H,5-6,10-11H2,1-4H3,(H,16,18) |
| InChIKey | OBLCYWBAOMWZFH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |