C22H31N3O5S — CID 16620430
2-[(4-ethoxy-3-methoxyphenyl)methyl-ethylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 16620430) has the molecular formula C22H31N3O5S and a molecular weight of 449.57 g/mol. Its IUPAC name is 2-[(4-ethoxy-3-methoxyphenyl)methyl-ethylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-[(4-ethoxy-3-methoxyphenyl)methyl-ethylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 16620430 |
| Molecular Formula | C22H31N3O5S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 2-[(4-ethoxy-3-methoxyphenyl)methyl-ethylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | CCOc1ccc(CN(CC)CC(=O)NCCc2ccc(S(N)(=O)=O)cc2)cc1OC |
| InChI | InChI=1S/C22H31N3O5S/c1-4-25(15-18-8-11-20(30-5-2)21(14-18)29-3)16-22(26)24-13-12-17-6-9-19(10-7-17)31(23,27)28/h6-11,14H,4-5,12-13,15-16H2,1-3H3,(H,24,26)(H2,23,27,28) |
| InChIKey | ZAFUSYLDQDWZSZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |