C22H29N3O4 — CID 16608734
N-(benzylcarbamoyl)-2-[(4-ethoxy-3-methoxyphenyl)methyl-ethylamino]acetamide (PubChem CID 16608734) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-(benzylcarbamoyl)-2-[(4-ethoxy-3-methoxyphenyl)methyl-ethylamino]acetamide.
| Compound Name | N-(benzylcarbamoyl)-2-[(4-ethoxy-3-methoxyphenyl)methyl-ethylamino]acetamide |
|---|---|
| PubChem CID | 16608734 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-(benzylcarbamoyl)-2-[(4-ethoxy-3-methoxyphenyl)methyl-ethylamino]acetamide |
| SMILES | CCOc1ccc(CN(CC)CC(=O)NC(=O)NCc2ccccc2)cc1OC |
| InChI | InChI=1S/C22H29N3O4/c1-4-25(15-18-11-12-19(29-5-2)20(13-18)28-3)16-21(26)24-22(27)23-14-17-9-7-6-8-10-17/h6-13H,4-5,14-16H2,1-3H3,(H2,23,24,26,27) |
| InChIKey | YIXIQHLNNNFRSB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |