C18H18ClN3O2 — CID 110881066
2-[benzyl(2-hydroxyethyl)amino]-N-(3-chloro-4-cyanophenyl)acetamide (PubChem CID 110881066) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is 2-[benzyl(2-hydroxyethyl)amino]-N-(3-chloro-4-cyanophenyl)acetamide.
| Compound Name | 2-[benzyl(2-hydroxyethyl)amino]-N-(3-chloro-4-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 110881066 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-[benzyl(2-hydroxyethyl)amino]-N-(3-chloro-4-cyanophenyl)acetamide |
| SMILES | N#Cc1ccc(NC(=O)CN(CCO)Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C18H18ClN3O2/c19-17-10-16(7-6-15(17)11-20)21-18(24)13-22(8-9-23)12-14-4-2-1-3-5-14/h1-7,10,23H,8-9,12-13H2,(H,21,24) |
| InChIKey | MWYOJHCEYAUKTE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |