C11H12ClN3O2 — CID 79463983
2-(2-aminoethoxy)-N-(3-chloro-4-cyanophenyl)acetamide (PubChem CID 79463983) has the molecular formula C11H12ClN3O2 and a molecular weight of 253.69 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-N-(3-chloro-4-cyanophenyl)acetamide.
| Compound Name | 2-(2-aminoethoxy)-N-(3-chloro-4-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 79463983 |
| Molecular Formula | C11H12ClN3O2 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2-(2-aminoethoxy)-N-(3-chloro-4-cyanophenyl)acetamide |
| SMILES | N#Cc1ccc(NC(=O)COCCN)cc1Cl |
| InChI | InChI=1S/C11H12ClN3O2/c12-10-5-9(2-1-8(10)6-14)15-11(16)7-17-4-3-13/h1-2,5H,3-4,7,13H2,(H,15,16) |
| InChIKey | FFKXJAACCNBXGC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|