C22H27ClN4O2 — CID 56540897
N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2-(diethylamino)-2-phenylacetamide (PubChem CID 56540897) has the molecular formula C22H27ClN4O2 and a molecular weight of 414.94 g/mol. Its IUPAC name is N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2-(diethylamino)-2-phenylacetamide.
| Compound Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2-(diethylamino)-2-phenylacetamide |
|---|---|
| PubChem CID | 56540897 |
| Molecular Formula | C22H27ClN4O2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2-(diethylamino)-2-phenylacetamide |
| SMILES | CCN(CC)C(C(=O)Nc1ccc(N2CCNC(=O)C2)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C22H27ClN4O2/c1-3-26(4-2)21(16-8-6-5-7-9-16)22(29)25-17-10-11-19(18(23)14-17)27-13-12-24-20(28)15-27/h5-11,14,21H,3-4,12-13,15H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | MZSMCOSEPOARRJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|