C21H28ClN5O2S — CID 51116798
1-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-[2-(diethylamino)-2-thiophen-3-ylethyl]urea (PubChem CID 51116798) has the molecular formula C21H28ClN5O2S and a molecular weight of 450.01 g/mol. Its IUPAC name is 1-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-[2-(diethylamino)-2-thiophen-3-ylethyl]urea.
| Compound Name | 1-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-[2-(diethylamino)-2-thiophen-3-ylethyl]urea |
|---|---|
| PubChem CID | 51116798 |
| Molecular Formula | C21H28ClN5O2S |
| Molecular Weight | 450.01 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 1-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-[2-(diethylamino)-2-thiophen-3-ylethyl]urea |
| SMILES | CCN(CC)C(CNC(=O)Nc1ccc(N2CCNC(=O)C2)c(Cl)c1)c1ccsc1 |
| InChI | InChI=1S/C21H28ClN5O2S/c1-3-26(4-2)19(15-7-10-30-14-15)12-24-21(29)25-16-5-6-18(17(22)11-16)27-9-8-23-20(28)13-27/h5-7,10-11,14,19H,3-4,8-9,12-13H2,1-2H3,(H,23,28)(H2,24,25,29) |
| InChIKey | GIBCQABHCFZPFG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.01 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|