C22H20ClN3O2 — CID 46435266
N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2-naphthalen-2-ylacetamide (PubChem CID 46435266) has the molecular formula C22H20ClN3O2 and a molecular weight of 393.87 g/mol. Its IUPAC name is N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2-naphthalen-2-ylacetamide.
| Compound Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 46435266 |
| Molecular Formula | C22H20ClN3O2 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2-naphthalen-2-ylacetamide |
| SMILES | O=C1CN(c2ccc(NC(=O)Cc3ccc4ccccc4c3)cc2Cl)CCN1 |
| InChI | InChI=1S/C22H20ClN3O2/c23-19-13-18(7-8-20(19)26-10-9-24-22(28)14-26)25-21(27)12-15-5-6-16-3-1-2-4-17(16)11-15/h1-8,11,13H,9-10,12,14H2,(H,24,28)(H,25,27) |
| InChIKey | RYIWTJYOVAVSQB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|