C22H20Cl2N4O3S — CID 46468209
N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]acetamide (PubChem CID 46468209) has the molecular formula C22H20Cl2N4O3S and a molecular weight of 491.40 g/mol. Its IUPAC name is N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 46468209 |
| Molecular Formula | C22H20Cl2N4O3S |
| Molecular Weight | 491.40 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]acetamide |
| SMILES | O=C1CN(c2ccc(NC(=O)Cc3csc(COc4ccc(Cl)cc4)n3)cc2Cl)CCN1 |
| InChI | InChI=1S/C22H20Cl2N4O3S/c23-14-1-4-17(5-2-14)31-12-22-27-16(13-32-22)10-20(29)26-15-3-6-19(18(24)9-15)28-8-7-25-21(30)11-28/h1-6,9,13H,7-8,10-12H2,(H,25,30)(H,26,29) |
| InChIKey | AIOUVJHQKVOBIY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|