C24H23ClN4O3 — CID 60509898
N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2-(4-methoxyanilino)benzamide (PubChem CID 60509898) has the molecular formula C24H23ClN4O3 and a molecular weight of 450.93 g/mol. Its IUPAC name is N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2-(4-methoxyanilino)benzamide.
| Compound Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2-(4-methoxyanilino)benzamide |
|---|---|
| PubChem CID | 60509898 |
| Molecular Formula | C24H23ClN4O3 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2-(4-methoxyanilino)benzamide |
| SMILES | COc1ccc(Nc2ccccc2C(=O)Nc2ccc(N3CCNC(=O)C3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H23ClN4O3/c1-32-18-9-6-16(7-10-18)27-21-5-3-2-4-19(21)24(31)28-17-8-11-22(20(25)14-17)29-13-12-26-23(30)15-29/h2-11,14,27H,12-13,15H2,1H3,(H,26,30)(H,28,31) |
| InChIKey | IMVFUJGCDGVTRV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|