C21H23ClFN3O5 — CID 59205015
5-chloro-N-[3-fluoro-4-(3-oxopiperazin-1-yl)phenyl]-2-(2-methoxyethoxymethoxy)benzamide (PubChem CID 59205015) has the molecular formula C21H23ClFN3O5 and a molecular weight of 451.88 g/mol. Its IUPAC name is 5-chloro-N-[3-fluoro-4-(3-oxopiperazin-1-yl)phenyl]-2-(2-methoxyethoxymethoxy)benzamide.
| Compound Name | 5-chloro-N-[3-fluoro-4-(3-oxopiperazin-1-yl)phenyl]-2-(2-methoxyethoxymethoxy)benzamide |
|---|---|
| PubChem CID | 59205015 |
| Molecular Formula | C21H23ClFN3O5 |
| Molecular Weight | 451.88 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 5-chloro-N-[3-fluoro-4-(3-oxopiperazin-1-yl)phenyl]-2-(2-methoxyethoxymethoxy)benzamide |
| SMILES | COCCOCOc1ccc(Cl)cc1C(=O)Nc1ccc(N2CCNC(=O)C2)c(F)c1 |
| InChI | InChI=1S/C21H23ClFN3O5/c1-29-8-9-30-13-31-19-5-2-14(22)10-16(19)21(28)25-15-3-4-18(17(23)11-15)26-7-6-24-20(27)12-26/h2-5,10-11H,6-9,12-13H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | FMMPLFXNVVFTCO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.88 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|