C28H36ClFN2O7 — CID 59204998
tert-butyl N-[4-[4-[[5-chloro-2-(2-methoxyethoxymethoxy)benzoyl]amino]-2-fluorophenoxy]cyclohexyl]carbamate (PubChem CID 59204998) has the molecular formula C28H36ClFN2O7 and a molecular weight of 567.05 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[[5-chloro-2-(2-methoxyethoxymethoxy)benzoyl]amino]-2-fluorophenoxy]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[[5-chloro-2-(2-methoxyethoxymethoxy)benzoyl]amino]-2-fluorophenoxy]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 59204998 |
| Molecular Formula | C28H36ClFN2O7 |
| Molecular Weight | 567.05 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | tert-butyl N-[4-[4-[[5-chloro-2-(2-methoxyethoxymethoxy)benzoyl]amino]-2-fluorophenoxy]cyclohexyl]carbamate |
| SMILES | COCCOCOc1ccc(Cl)cc1C(=O)Nc1ccc(OC2CCC(NC(=O)OC(C)(C)C)CC2)c(F)c1 |
| InChI | InChI=1S/C28H36ClFN2O7/c1-28(2,3)39-27(34)32-19-6-9-21(10-7-19)38-25-12-8-20(16-23(25)30)31-26(33)22-15-18(29)5-11-24(22)37-17-36-14-13-35-4/h5,8,11-12,15-16,19,21H,6-7,9-10,13-14,17H2,1-4H3,(H,31,33)(H,32,34) |
| InChIKey | BRSOKSHHLRMLBN-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.05 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|