C21H20ClF3N2O3 — CID 155556041
[4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-cyclohexylcarbamate (PubChem CID 155556041) has the molecular formula C21H20ClF3N2O3 and a molecular weight of 440.85 g/mol. Its IUPAC name is [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-cyclohexylcarbamate.
| Compound Name | [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 155556041 |
| Molecular Formula | C21H20ClF3N2O3 |
| Molecular Weight | 440.85 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)Oc1ccc(Cl)cc1C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H20ClF3N2O3/c22-14-8-11-18(30-20(29)27-15-4-2-1-3-5-15)17(12-14)19(28)26-16-9-6-13(7-10-16)21(23,24)25/h6-12,15H,1-5H2,(H,26,28)(H,27,29) |
| InChIKey | GAQGNXGPNKBFLO-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.85 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |