C20H14Cl2N2O3 — CID 127028067
[4-chloro-2-[(4-chlorophenyl)carbamoyl]phenyl] N-phenylcarbamate (PubChem CID 127028067) has the molecular formula C20H14Cl2N2O3 and a molecular weight of 401.25 g/mol. Its IUPAC name is [4-chloro-2-[(4-chlorophenyl)carbamoyl]phenyl] N-phenylcarbamate.
| Compound Name | [4-chloro-2-[(4-chlorophenyl)carbamoyl]phenyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 127028067 |
| Molecular Formula | C20H14Cl2N2O3 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | [4-chloro-2-[(4-chlorophenyl)carbamoyl]phenyl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)Oc1ccc(Cl)cc1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H14Cl2N2O3/c21-13-6-9-16(10-7-13)23-19(25)17-12-14(22)8-11-18(17)27-20(26)24-15-4-2-1-3-5-15/h1-12H,(H,23,25)(H,24,26) |
| InChIKey | OYSSRZMGKIFYKX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |