C24H30Cl2N2O3 — CID 46231703
[4-chloro-2-[(3-chlorophenyl)carbamoyl]phenyl] N-decylcarbamate (PubChem CID 46231703) has the molecular formula C24H30Cl2N2O3 and a molecular weight of 465.42 g/mol. Its IUPAC name is [4-chloro-2-[(3-chlorophenyl)carbamoyl]phenyl] N-decylcarbamate.
| Compound Name | [4-chloro-2-[(3-chlorophenyl)carbamoyl]phenyl] N-decylcarbamate |
|---|---|
| PubChem CID | 46231703 |
| Molecular Formula | C24H30Cl2N2O3 |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | [4-chloro-2-[(3-chlorophenyl)carbamoyl]phenyl] N-decylcarbamate |
| SMILES | CCCCCCCCCCNC(=O)Oc1ccc(Cl)cc1C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H30Cl2N2O3/c1-2-3-4-5-6-7-8-9-15-27-24(30)31-22-14-13-19(26)17-21(22)23(29)28-20-12-10-11-18(25)16-20/h10-14,16-17H,2-9,15H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | IMOVDILPVGSAKX-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|