C17H13Cl2F3N2O3 — CID 122188848
[4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-(2-chloroethyl)carbamate (PubChem CID 122188848) has the molecular formula C17H13Cl2F3N2O3 and a molecular weight of 421.20 g/mol. Its IUPAC name is [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-(2-chloroethyl)carbamate.
| Compound Name | [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-(2-chloroethyl)carbamate |
|---|---|
| PubChem CID | 122188848 |
| Molecular Formula | C17H13Cl2F3N2O3 |
| Molecular Weight | 421.20 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-(2-chloroethyl)carbamate |
| SMILES | O=C(NCCCl)Oc1ccc(Cl)cc1C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13Cl2F3N2O3/c18-7-8-23-16(26)27-14-6-3-11(19)9-13(14)15(25)24-12-4-1-10(2-5-12)17(20,21)22/h1-6,9H,7-8H2,(H,23,26)(H,24,25) |
| InChIKey | BEWYUDMYAZSSQQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.20 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|