C25H20ClF3N2O5 — CID 91386618
[4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] 3-formamido-2-phenylmethoxypropanoate (PubChem CID 91386618) has the molecular formula C25H20ClF3N2O5 and a molecular weight of 520.89 g/mol. Its IUPAC name is [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] 3-formamido-2-phenylmethoxypropanoate.
| Compound Name | [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] 3-formamido-2-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 91386618 |
| Molecular Formula | C25H20ClF3N2O5 |
| Molecular Weight | 520.89 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] 3-formamido-2-phenylmethoxypropanoate |
| SMILES | O=CNCC(OCc1ccccc1)C(=O)Oc1ccc(Cl)cc1C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H20ClF3N2O5/c26-18-8-11-21(20(12-18)23(33)31-19-9-6-17(7-10-19)25(27,28)29)36-24(34)22(13-30-15-32)35-14-16-4-2-1-3-5-16/h1-12,15,22H,13-14H2,(H,30,32)(H,31,33) |
| InChIKey | ZMUNFXDYMSDIJI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.89 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|