C30H24Cl2N2O5 — CID 44574093
[4-chloro-2-[(4-chlorophenyl)carbamoyl]phenyl] (2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 44574093) has the molecular formula C30H24Cl2N2O5 and a molecular weight of 563.44 g/mol. Its IUPAC name is [4-chloro-2-[(4-chlorophenyl)carbamoyl]phenyl] (2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | [4-chloro-2-[(4-chlorophenyl)carbamoyl]phenyl] (2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 44574093 |
| Molecular Formula | C30H24Cl2N2O5 |
| Molecular Weight | 563.44 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | [4-chloro-2-[(4-chlorophenyl)carbamoyl]phenyl] (2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | O=C(N[C@H](Cc1ccccc1)C(=O)Oc1ccc(Cl)cc1C(=O)Nc1ccc(Cl)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C30H24Cl2N2O5/c31-22-11-14-24(15-12-22)33-28(35)25-18-23(32)13-16-27(25)39-29(36)26(17-20-7-3-1-4-8-20)34-30(37)38-19-21-9-5-2-6-10-21/h1-16,18,26H,17,19H2,(H,33,35)(H,34,37)/t26-/m1/s1 |
| InChIKey | QDPWNWSQHBOYLM-AREMUKBSSA-N |
| XLogP | 6.69 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.44 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|